About ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate
ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate (PubChem CID 160584582) has the molecular formula C31H30N4O4
and a molecular weight of 522.61 g/mol. Its IUPAC name is ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate |
| PubChem CID | 160584582 |
| Molecular Formula | C31H30N4O4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(Cc2ccccc2)n1.CCOC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H18N2O2.C12H12N2O2/c1-2-23-19(22)17-13-18(16-11-7-4-8-12-16)21(20-17)14-15-9-5-3-6-10-15;1-2-16-12(15)11-8-10(13-14-11)9-6-4-3-5-7-9/h3-13H,2,14H2,1H3;3-8H,2H2,1H3,(H,13,14) |
| InChIKey | RCFOMNHSKJQAKA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate?
The IUPAC name of ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate (CID 160584582) is ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate.
What is the SMILES notation for ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate?
The canonical SMILES for ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate is CCOC(=O)c1cc(-c2ccccc2)n(Cc2ccccc2)n1.CCOC(=O)c1cc(-c2ccccc2)n[nH]1.
What is the InChIKey of ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate?
The InChIKey is RCFOMNHSKJQAKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2.C12H12N2O2/c1-2-23-19(22)17-13-18(16-11-7-4-8-12-16)21(20-17)14-15-9-5-3-6-10-15;1-2-16-12(15)11-8-10(13-14-11)9-6-4-3-5-7-9/h3-13H,2,14H2,1H3;3-8H,2H2,1H3,(H,13,14).
What are the key properties of ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate?
ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate has a molecular weight of 522.61 g/mol, XLogP of 6.03, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-5-phenylpyrazole-3-carboxylate;ethyl 3-phenyl-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 160584582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).