C15H19F2NO2 — CID 160585266
(3S,4R,5S)-4-[(1S)-1-amino-2-fluoro-1-(2-fluorophenyl)ethyl]-5-prop-2-enyloxolan-3-ol (PubChem CID 160585266) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is (3S,4R,5S)-4-[(1S)-1-amino-2-fluoro-1-(2-fluorophenyl)ethyl]-5-prop-2-enyloxolan-3-ol.
| Compound Name | (3S,4R,5S)-4-[(1S)-1-amino-2-fluoro-1-(2-fluorophenyl)ethyl]-5-prop-2-enyloxolan-3-ol |
|---|---|
| PubChem CID | 160585266 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3S,4R,5S)-4-[(1S)-1-amino-2-fluoro-1-(2-fluorophenyl)ethyl]-5-prop-2-enyloxolan-3-ol |
| SMILES | C=CC[C@@H]1OC[C@@H](O)[C@H]1[C@@](N)(CF)c1ccccc1F |
| InChI | InChI=1S/C15H19F2NO2/c1-2-5-13-14(12(19)8-20-13)15(18,9-16)10-6-3-4-7-11(10)17/h2-4,6-7,12-14,19H,1,5,8-9,18H2/t12-,13+,14-,15-/m1/s1 |
| InChIKey | UAITZHIXEJKOCY-LXTVHRRPSA-N |
| XLogP | 1.90 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|