C29H26N6 — CID 160585473
2-[5-[5-(4-methylpiperazin-1-yl)-3H-indol-2-yl]-3H-indol-2-yl]quinoxaline (PubChem CID 160585473) has the molecular formula C29H26N6 and a molecular weight of 458.57 g/mol. Its IUPAC name is 2-[5-[5-(4-methylpiperazin-1-yl)-3H-indol-2-yl]-3H-indol-2-yl]quinoxaline.
| Compound Name | 2-[5-[5-(4-methylpiperazin-1-yl)-3H-indol-2-yl]-3H-indol-2-yl]quinoxaline |
|---|---|
| PubChem CID | 160585473 |
| Molecular Formula | C29H26N6 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-[5-[5-(4-methylpiperazin-1-yl)-3H-indol-2-yl]-3H-indol-2-yl]quinoxaline |
| SMILES | CN1CCN(c2ccc3c(c2)CC(c2ccc4c(c2)CC(c2cnc5ccccc5n2)=N4)=N3)CC1 |
| InChI | InChI=1S/C29H26N6/c1-34-10-12-35(13-11-34)22-7-9-24-21(15-22)16-27(31-24)19-6-8-23-20(14-19)17-28(32-23)29-18-30-25-4-2-3-5-26(25)33-29/h2-9,14-15,18H,10-13,16-17H2,1H3 |
| InChIKey | FKSKCDHVSXJKTE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|