C7H4F5NO — CID 160585711
formamide;1,2,3,4,5-pentafluorobenzene (PubChem CID 160585711) has the molecular formula C7H4F5NO and a molecular weight of 213.11 g/mol. Its IUPAC name is formamide;1,2,3,4,5-pentafluorobenzene.
| Compound Name | formamide;1,2,3,4,5-pentafluorobenzene |
|---|---|
| PubChem CID | 160585711 |
| Molecular Formula | C7H4F5NO |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | formamide;1,2,3,4,5-pentafluorobenzene |
| SMILES | Fc1cc(F)c(F)c(F)c1F.NC=O |
| InChI | InChI=1S/C6HF5.CH3NO/c7-2-1-3(8)5(10)6(11)4(2)9;2-1-3/h1H;1H,(H2,2,3) |
| InChIKey | RCJBDJDQOIKAEF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|