C31H42N2O7S2 — CID 160587389
2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]ethyl methanesulfonate;2-[4-[2-[methyl(prop-2-ynyl)amino]propyl]phenoxy]ethyl methanesulfonate (PubChem CID 160587389) has the molecular formula C31H42N2O7S2 and a molecular weight of 618.82 g/mol. Its IUPAC name is 2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]ethyl methanesulfonate;2-[4-[2-[methyl(prop-2-ynyl)amino]propyl]phenoxy]ethyl methanesulfonate.
| Compound Name | 2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]ethyl methanesulfonate;2-[4-[2-[methyl(prop-2-ynyl)amino]propyl]phenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 160587389 |
| Molecular Formula | C31H42N2O7S2 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]ethyl methanesulfonate;2-[4-[2-[methyl(prop-2-ynyl)amino]propyl]phenoxy]ethyl methanesulfonate |
| SMILES | C#CCN(C)C(C)Cc1ccc(OCCOS(C)(=O)=O)cc1.C#CCN(CCOS(C)(=O)=O)C1CCc2ccccc21 |
| InChI | InChI=1S/C16H23NO4S.C15H19NO3S/c1-5-10-17(3)14(2)13-15-6-8-16(9-7-15)20-11-12-21-22(4,18)19;1-3-10-16(11-12-19-20(2,17)18)15-9-8-13-6-4-5-7-14(13)15/h1,6-9,14H,10-13H2,2-4H3;1,4-7,15H,8-12H2,2H3 |
| InChIKey | RCOMVQMWBIMHAU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|