C29H32N6O3S2 — CID 160589357
5-cyclohexyl-13-(2-hydroxyethylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;2-methyl-3-(4-methylphenyl)-5-sulfanylpyrimidin-4-one (PubChem CID 160589357) has the molecular formula C29H32N6O3S2 and a molecular weight of 576.75 g/mol. Its IUPAC name is 5-cyclohexyl-13-(2-hydroxyethylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;2-methyl-3-(4-methylphenyl)-5-sulfanylpyrimidin-4-one.
| Compound Name | 5-cyclohexyl-13-(2-hydroxyethylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;2-methyl-3-(4-methylphenyl)-5-sulfanylpyrimidin-4-one |
|---|---|
| PubChem CID | 160589357 |
| Molecular Formula | C29H32N6O3S2 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 5-cyclohexyl-13-(2-hydroxyethylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;2-methyl-3-(4-methylphenyl)-5-sulfanylpyrimidin-4-one |
| SMILES | Cc1ccc(-n2c(C)ncc(S)c2=O)cc1.O=c1c2sc3nccc(NCCO)c3c2ncn1C1CCCCC1 |
| InChI | InChI=1S/C17H20N4O2S.C12H12N2OS/c22-9-8-18-12-6-7-19-16-13(12)14-15(24-16)17(23)21(10-20-14)11-4-2-1-3-5-11;1-8-3-5-10(6-4-8)14-9(2)13-7-11(16)12(14)15/h6-7,10-11,22H,1-5,8-9H2,(H,18,19);3-7,16H,1-2H3 |
| InChIKey | RCUOGUIVRCWIRO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|