C18H18FN5O5 — CID 160591674
(4-fluoro-3-methylphenyl)methanamine;methyl 7-acetyl-3-nitropyrazolo[1,5-a]pyrimidine-5-carboxylate (PubChem CID 160591674) has the molecular formula C18H18FN5O5 and a molecular weight of 403.37 g/mol. Its IUPAC name is (4-fluoro-3-methylphenyl)methanamine;methyl 7-acetyl-3-nitropyrazolo[1,5-a]pyrimidine-5-carboxylate.
| Compound Name | (4-fluoro-3-methylphenyl)methanamine;methyl 7-acetyl-3-nitropyrazolo[1,5-a]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 160591674 |
| Molecular Formula | C18H18FN5O5 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (4-fluoro-3-methylphenyl)methanamine;methyl 7-acetyl-3-nitropyrazolo[1,5-a]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cc(C(C)=O)n2ncc([N+](=O)[O-])c2n1.Cc1cc(CN)ccc1F |
| InChI | InChI=1S/C10H8N4O5.C8H10FN/c1-5(15)7-3-6(10(16)19-2)12-9-8(14(17)18)4-11-13(7)9;1-6-4-7(5-10)2-3-8(6)9/h3-4H,1-2H3;2-4H,5,10H2,1H3 |
| InChIKey | IYPHBWGMDMLXCZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|