C17H22N2O2 — CID 160593083
1-[2-(4-nitrophenyl)ethyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline (PubChem CID 160593083) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-[2-(4-nitrophenyl)ethyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline.
| Compound Name | 1-[2-(4-nitrophenyl)ethyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline |
|---|---|
| PubChem CID | 160593083 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[2-(4-nitrophenyl)ethyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline |
| SMILES | O=[N+]([O-])c1ccc(CCC2NCCC3=C2CCCC3)cc1 |
| InChI | InChI=1S/C17H22N2O2/c20-19(21)15-8-5-13(6-9-15)7-10-17-16-4-2-1-3-14(16)11-12-18-17/h5-6,8-9,17-18H,1-4,7,10-12H2 |
| InChIKey | RDGXFFLDSHZSSB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|