About 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine
2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine (PubChem CID 160596010) has the molecular formula C7H18I2N6O7
and a molecular weight of 552.06 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine |
| PubChem CID | 160596010 |
| Molecular Formula | C7H18I2N6O7 |
| Molecular Weight | 552.06 g/mol |
| Exact Mass | 551.93 |
| IUPAC Name | 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine |
| SMILES | CN(C)CCO[N+](=O)[O-].CN(CN(C)[N+](=O)[O-])[N+](=O)[O-].II |
| InChI | InChI=1S/C4H10N2O3.C3H8N4O4.I2/c1-5(2)3-4-9-6(7)8;1-4(6(8)9)3-5(2)7(10)11;1-2/h3-4H2,1-2H3;3H2,1-2H3; |
| InChIKey | RDQIVDWKXYTTHE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 148.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 552.06 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine?
The IUPAC name of 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine (CID 160596010) is 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine.
What is the SMILES notation for 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine?
The canonical SMILES for 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine is CN(C)CCO[N+](=O)[O-].CN(CN(C)[N+](=O)[O-])[N+](=O)[O-].II.
What is the InChIKey of 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine?
The InChIKey is RDQIVDWKXYTTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O3.C3H8N4O4.I2/c1-5(2)3-4-9-6(7)8;1-4(6(8)9)3-5(2)7(10)11;1-2/h3-4H2,1-2H3;3H2,1-2H3;.
What are the key properties of 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine?
2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine has a molecular weight of 552.06 g/mol, XLogP of 0.72, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl nitrate;N-methyl-N-[[methyl(nitro)amino]methyl]nitramide;molecular iodine is sourced from PubChem (CID 160596010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).