C21H31F3N4O3S — CID 160597437
(1,1-dioxo-1,4-thiazinan-4-yl)-[4-(trifluoromethyl)-2-[[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]pyrimidin-5-yl]methanone;methane (PubChem CID 160597437) has the molecular formula C21H31F3N4O3S and a molecular weight of 476.57 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[4-(trifluoromethyl)-2-[[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]pyrimidin-5-yl]methanone;methane.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[4-(trifluoromethyl)-2-[[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]pyrimidin-5-yl]methanone;methane |
|---|---|
| PubChem CID | 160597437 |
| Molecular Formula | C21H31F3N4O3S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[4-(trifluoromethyl)-2-[[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]pyrimidin-5-yl]methanone;methane |
| SMILES | C.CC1(C)[C@@H]2CC[C@@](C)(C2)[C@@H]1Nc1ncc(C(=O)N2CCS(=O)(=O)CC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H27F3N4O3S.CH4/c1-18(2)12-4-5-19(3,10-12)16(18)26-17-24-11-13(14(25-17)20(21,22)23)15(28)27-6-8-31(29,30)9-7-27;/h11-12,16H,4-10H2,1-3H3,(H,24,25,26);1H4/t12-,16-,19+;/m1./s1 |
| InChIKey | RDUYVUJNUKMZPL-XBJRIODESA-N |
| XLogP | 3.63 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |