C27H15F5N2O6S2 — CID 160598952
2-[(2,3-difluoro-4-methylphenyl)sulfonylmethyl]-3-[(2,3,4-trifluorophenyl)sulfonylmethyl]benzo[g]quinoxaline-5,10-dione (PubChem CID 160598952) has the molecular formula C27H15F5N2O6S2 and a molecular weight of 622.55 g/mol. Its IUPAC name is 2-[(2,3-difluoro-4-methylphenyl)sulfonylmethyl]-3-[(2,3,4-trifluorophenyl)sulfonylmethyl]benzo[g]quinoxaline-5,10-dione.
| Compound Name | 2-[(2,3-difluoro-4-methylphenyl)sulfonylmethyl]-3-[(2,3,4-trifluorophenyl)sulfonylmethyl]benzo[g]quinoxaline-5,10-dione |
|---|---|
| PubChem CID | 160598952 |
| Molecular Formula | C27H15F5N2O6S2 |
| Molecular Weight | 622.55 g/mol |
| Exact Mass | 622.03 |
| IUPAC Name | 2-[(2,3-difluoro-4-methylphenyl)sulfonylmethyl]-3-[(2,3,4-trifluorophenyl)sulfonylmethyl]benzo[g]quinoxaline-5,10-dione |
| SMILES | Cc1ccc(S(=O)(=O)Cc2nc3c(nc2CS(=O)(=O)c2ccc(F)c(F)c2F)C(=O)c2ccccc2C3=O)c(F)c1F |
| InChI | InChI=1S/C27H15F5N2O6S2/c1-12-6-8-18(22(31)20(12)29)41(37,38)10-16-17(11-42(39,40)19-9-7-15(28)21(30)23(19)32)34-25-24(33-16)26(35)13-4-2-3-5-14(13)27(25)36/h2-9H,10-11H2,1H3 |
| InChIKey | QEVPLNKIUNAURC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 128.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|