About 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one
4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one (PubChem CID 160600227) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one.
Molecular Properties
| Compound Name | 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one |
| PubChem CID | 160600227 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one |
| SMILES | Cc1c(NCCN)c2cc(O)c(O)cc2oc1=O |
| InChI | InChI=1S/C12H14N2O4/c1-6-11(14-3-2-13)7-4-8(15)9(16)5-10(7)18-12(6)17/h4-5,14-16H,2-3,13H2,1H3 |
| InChIKey | REEDGXRWBFFEFF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one?
The IUPAC name of 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one (CID 160600227) is 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one.
What is the SMILES notation for 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one?
The canonical SMILES for 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one is Cc1c(NCCN)c2cc(O)c(O)cc2oc1=O.
What is the InChIKey of 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one?
The InChIKey is REEDGXRWBFFEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4/c1-6-11(14-3-2-13)7-4-8(15)9(16)5-10(7)18-12(6)17/h4-5,14-16H,2-3,13H2,1H3.
What are the key properties of 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one?
4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one has a molecular weight of 250.25 g/mol, XLogP of 0.88, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethylamino)-6,7-dihydroxy-3-methylchromen-2-one is sourced from PubChem (CID 160600227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).