About fluoroform;hexyl(trimethyl)azanium
fluoroform;hexyl(trimethyl)azanium (PubChem CID 160600313) has the molecular formula C10H23F3N+
and a molecular weight of 214.29 g/mol. Its IUPAC name is fluoroform;hexyl(trimethyl)azanium.
Molecular Properties
| Compound Name | fluoroform;hexyl(trimethyl)azanium |
| PubChem CID | 160600313 |
| Molecular Formula | C10H23F3N+ |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | fluoroform;hexyl(trimethyl)azanium |
| SMILES | CCCCCC[N+](C)(C)C.FC(F)F |
| InChI | InChI=1S/C9H22N.CHF3/c1-5-6-7-8-9-10(2,3)4;2-1(3)4/h5-9H2,1-4H3;1H/q+1; |
| InChIKey | REEJTCXUAYXCAP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze fluoroform;hexyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;hexyl(trimethyl)azanium?
The IUPAC name of fluoroform;hexyl(trimethyl)azanium (CID 160600313) is fluoroform;hexyl(trimethyl)azanium.
What is the SMILES notation for fluoroform;hexyl(trimethyl)azanium?
The canonical SMILES for fluoroform;hexyl(trimethyl)azanium is CCCCCC[N+](C)(C)C.FC(F)F.
What is the InChIKey of fluoroform;hexyl(trimethyl)azanium?
The InChIKey is REEJTCXUAYXCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N.CHF3/c1-5-6-7-8-9-10(2,3)4;2-1(3)4/h5-9H2,1-4H3;1H/q+1;.
What are the key properties of fluoroform;hexyl(trimethyl)azanium?
fluoroform;hexyl(trimethyl)azanium has a molecular weight of 214.29 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;hexyl(trimethyl)azanium is sourced from PubChem (CID 160600313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).