C28H35FN2O5 — CID 160600941
4-[2-[4-[(1R,3R)-3-[(2S)-2-(4-fluoro-3-methoxyphenyl)propyl]cyclopentyl]phenyl]acetyl]piperazin-2-one;formic acid (PubChem CID 160600941) has the molecular formula C28H35FN2O5 and a molecular weight of 498.60 g/mol. Its IUPAC name is 4-[2-[4-[(1R,3R)-3-[(2S)-2-(4-fluoro-3-methoxyphenyl)propyl]cyclopentyl]phenyl]acetyl]piperazin-2-one;formic acid.
| Compound Name | 4-[2-[4-[(1R,3R)-3-[(2S)-2-(4-fluoro-3-methoxyphenyl)propyl]cyclopentyl]phenyl]acetyl]piperazin-2-one;formic acid |
|---|---|
| PubChem CID | 160600941 |
| Molecular Formula | C28H35FN2O5 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 4-[2-[4-[(1R,3R)-3-[(2S)-2-(4-fluoro-3-methoxyphenyl)propyl]cyclopentyl]phenyl]acetyl]piperazin-2-one;formic acid |
| SMILES | COc1cc([C@@H](C)C[C@H]2CC[C@@H](c3ccc(CC(=O)N4CCNC(=O)C4)cc3)C2)ccc1F.O=CO |
| InChI | InChI=1S/C27H33FN2O3.CH2O2/c1-18(22-9-10-24(28)25(16-22)33-2)13-20-5-8-23(14-20)21-6-3-19(4-7-21)15-27(32)30-12-11-29-26(31)17-30;2-1-3/h3-4,6-7,9-10,16,18,20,23H,5,8,11-15,17H2,1-2H3,(H,29,31);1H,(H,2,3)/t18-,20+,23+;/m0./s1 |
| InChIKey | REGMUBHBBIWBNC-GWZVDPBBSA-N |
| XLogP | 4.11 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|