C29H32F4N4O6 — CID 160601589
ethyl 2-[[7-fluoro-1'-(2-phenoxyethyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,3'-pyrrolidine]-2-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid (PubChem CID 160601589) has the molecular formula C29H32F4N4O6 and a molecular weight of 608.59 g/mol. Its IUPAC name is ethyl 2-[[7-fluoro-1'-(2-phenoxyethyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,3'-pyrrolidine]-2-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[[7-fluoro-1'-(2-phenoxyethyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,3'-pyrrolidine]-2-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160601589 |
| Molecular Formula | C29H32F4N4O6 |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | ethyl 2-[[7-fluoro-1'-(2-phenoxyethyl)spiro[4,9-dihydro-3H-pyrido[3,4-b]indole-1,3'-pyrrolidine]-2-carbonyl]amino]acetate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)CNC(=O)N1CCc2c([nH]c3cc(F)ccc23)C12CCN(CCOc1ccccc1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H31FN4O4.C2HF3O2/c1-2-35-24(33)17-29-26(34)32-12-10-22-21-9-8-19(28)16-23(21)30-25(22)27(32)11-13-31(18-27)14-15-36-20-6-4-3-5-7-20;3-2(4,5)1(6)7/h3-9,16,30H,2,10-15,17-18H2,1H3,(H,29,34);(H,6,7) |
| InChIKey | REIQAIPPBCOEIY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |