C22H26N6O8 — CID 160601624
dimethyl propanedioate;1-(6-methyl-2-pyridinyl)-1,3-diazinane-2,4,6-trione;(6-methyl-2-pyridinyl)urea (PubChem CID 160601624) has the molecular formula C22H26N6O8 and a molecular weight of 502.48 g/mol. Its IUPAC name is dimethyl propanedioate;1-(6-methyl-2-pyridinyl)-1,3-diazinane-2,4,6-trione;(6-methyl-2-pyridinyl)urea.
| Compound Name | dimethyl propanedioate;1-(6-methyl-2-pyridinyl)-1,3-diazinane-2,4,6-trione;(6-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 160601624 |
| Molecular Formula | C22H26N6O8 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | dimethyl propanedioate;1-(6-methyl-2-pyridinyl)-1,3-diazinane-2,4,6-trione;(6-methyl-2-pyridinyl)urea |
| SMILES | COC(=O)CC(=O)OC.Cc1cccc(N2C(=O)CC(=O)NC2=O)n1.Cc1cccc(NC(N)=O)n1 |
| InChI | InChI=1S/C10H9N3O3.C7H9N3O.C5H8O4/c1-6-3-2-4-7(11-6)13-9(15)5-8(14)12-10(13)16;1-5-3-2-4-6(9-5)10-7(8)11;1-8-4(6)3-5(7)9-2/h2-4H,5H2,1H3,(H,12,14,16);2-4H,1H3,(H3,8,9,10,11);3H2,1-2H3 |
| InChIKey | REISMWNELKPHNH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 199.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|