C35H68O10 — CID 160601932
methoxymethyl 2,2,4,4-tetramethylpentanoate;1-propan-2-yloxycarbonyloxyethyl 2,2,4,4-tetramethylpentanoate;2,4,4-trimethyl-2-(trideuteriomethyl)pentanoic acid (PubChem CID 160601932) has the molecular formula C35H68O10 and a molecular weight of 651.94 g/mol. Its IUPAC name is methoxymethyl 2,2,4,4-tetramethylpentanoate;1-propan-2-yloxycarbonyloxyethyl 2,2,4,4-tetramethylpentanoate;2,4,4-trimethyl-2-(trideuteriomethyl)pentanoic acid.
| Compound Name | methoxymethyl 2,2,4,4-tetramethylpentanoate;1-propan-2-yloxycarbonyloxyethyl 2,2,4,4-tetramethylpentanoate;2,4,4-trimethyl-2-(trideuteriomethyl)pentanoic acid |
|---|---|
| PubChem CID | 160601932 |
| Molecular Formula | C35H68O10 |
| Molecular Weight | 651.94 g/mol |
| Exact Mass | 651.50 |
| IUPAC Name | methoxymethyl 2,2,4,4-tetramethylpentanoate;1-propan-2-yloxycarbonyloxyethyl 2,2,4,4-tetramethylpentanoate;2,4,4-trimethyl-2-(trideuteriomethyl)pentanoic acid |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)C(C)(C)CC(C)(C)C.COCOC(=O)C(C)(C)CC(C)(C)C.[2H]C([2H])([2H])C(C)(CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H28O5.C11H22O3.C9H18O2/c1-10(2)18-13(17)20-11(3)19-12(16)15(7,8)9-14(4,5)6;1-10(2,3)7-11(4,5)9(12)14-8-13-6;1-8(2,3)6-9(4,5)7(10)11/h10-11H,9H2,1-8H3;7-8H2,1-6H3;6H2,1-5H3,(H,10,11)/i;;4D3 |
| InChIKey | REJQWGJUJQEOEI-UMCVOSPMSA-N |
| XLogP | 9.03 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.94 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|