About 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate
2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate (PubChem CID 160602098) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate.
Molecular Properties
| Compound Name | 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate |
| PubChem CID | 160602098 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate |
| SMILES | CCON=C(CC)C1=C(O)CC(c2ccccc2)CC1=O.O |
| InChI | InChI=1S/C17H21NO3.H2O/c1-3-14(18-21-4-2)17-15(19)10-13(11-16(17)20)12-8-6-5-7-9-12;/h5-9,13,19H,3-4,10-11H2,1-2H3;1H2 |
| InChIKey | UVESBQGWXUDSLS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate?
The IUPAC name of 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate (CID 160602098) is 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate.
What is the SMILES notation for 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate?
The canonical SMILES for 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate is CCON=C(CC)C1=C(O)CC(c2ccccc2)CC1=O.O.
What is the InChIKey of 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate?
The InChIKey is UVESBQGWXUDSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3.H2O/c1-3-14(18-21-4-2)17-15(19)10-13(11-16(17)20)12-8-6-5-7-9-12;/h5-9,13,19H,3-4,10-11H2,1-2H3;1H2.
What are the key properties of 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate?
2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate has a molecular weight of 305.37 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxy-5-phenylcyclohex-2-en-1-one;hydrate is sourced from PubChem (CID 160602098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).