About titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride
titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride (PubChem CID 160602181) has the molecular formula C12H13Cl3Ti
and a molecular weight of 311.46 g/mol. Its IUPAC name is titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride.
Molecular Properties
| Compound Name | titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride |
| PubChem CID | 160602181 |
| Molecular Formula | C12H13Cl3Ti |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride |
| SMILES | Cc1cc2c(C)ccc(C)c2[cH-]1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C12H13.3ClH.Ti/c1-8-6-11-9(2)4-5-10(3)12(11)7-8;;;;/h4-7H,1-3H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | JRCAVOLEKKQQHP-UHFFFAOYSA-K |
| XLogP | -5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | -5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride?
The IUPAC name of titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride (CID 160602181) is titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride.
What is the SMILES notation for titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride?
The canonical SMILES for titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride is Cc1cc2c(C)ccc(C)c2[cH-]1.[Cl-].[Cl-].[Cl-].[Ti+4].
What is the InChIKey of titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride?
The InChIKey is JRCAVOLEKKQQHP-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H13.3ClH.Ti/c1-8-6-11-9(2)4-5-10(3)12(11)7-8;;;;/h4-7H,1-3H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride?
titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride has a molecular weight of 311.46 g/mol, XLogP of -5.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for titanium(4+);2,4,7-trimethyl-1H-inden-1-ide;trichloride is sourced from PubChem (CID 160602181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).