C19H30O3 — CID 160602739
2-[(E)-3-hydroxy-3,6-dimethyloct-5-enyl]-3,5,6-trimethylbenzene-1,4-diol (PubChem CID 160602739) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-[(E)-3-hydroxy-3,6-dimethyloct-5-enyl]-3,5,6-trimethylbenzene-1,4-diol.
| Compound Name | 2-[(E)-3-hydroxy-3,6-dimethyloct-5-enyl]-3,5,6-trimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 160602739 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-[(E)-3-hydroxy-3,6-dimethyloct-5-enyl]-3,5,6-trimethylbenzene-1,4-diol |
| SMILES | CC/C(C)=C/CC(C)(O)CCc1c(C)c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C19H30O3/c1-7-12(2)8-10-19(6,22)11-9-16-15(5)17(20)13(3)14(4)18(16)21/h8,20-22H,7,9-11H2,1-6H3/b12-8+ |
| InChIKey | YJJVIXNIFQSEDI-XYOKQWHBSA-N |
| XLogP | 4.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|