C10H22O4S — CID 160603788
(3-methoxy-2,3-dimethylbutan-2-yl) propane-1-sulfonate (PubChem CID 160603788) has the molecular formula C10H22O4S and a molecular weight of 238.35 g/mol. Its IUPAC name is (3-methoxy-2,3-dimethylbutan-2-yl) propane-1-sulfonate.
| Compound Name | (3-methoxy-2,3-dimethylbutan-2-yl) propane-1-sulfonate |
|---|---|
| PubChem CID | 160603788 |
| Molecular Formula | C10H22O4S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (3-methoxy-2,3-dimethylbutan-2-yl) propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OC(C)(C)C(C)(C)OC |
| InChI | InChI=1S/C10H22O4S/c1-7-8-15(11,12)14-10(4,5)9(2,3)13-6/h7-8H2,1-6H3 |
| InChIKey | REPQPYZDJGQCCU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|