C36H24F6N6O6S2 — CID 160604817
[[(2R,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl]-(fluoromethyl)-oxo-λ6-sulfanylidene]cyanamide (PubChem CID 160604817) has the molecular formula C36H24F6N6O6S2 and a molecular weight of 814.75 g/mol. Its IUPAC name is [[(2R,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl]-(fluoromethyl)-oxo-λ6-sulfanylidene]cyanamide.
| Compound Name | [[(2R,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl]-(fluoromethyl)-oxo-λ6-sulfanylidene]cyanamide |
|---|---|
| PubChem CID | 160604817 |
| Molecular Formula | C36H24F6N6O6S2 |
| Molecular Weight | 814.75 g/mol |
| Exact Mass | 814.11 |
| IUPAC Name | [[(2R,3S)-7-(3-cyano-5-fluorophenoxy)-2-fluoro-3-hydroxy-2,3-dihydro-1H-inden-4-yl]-(fluoromethyl)-oxo-λ6-sulfanylidene]cyanamide |
| SMILES | N#CN=S(=O)(CF)c1ccc(Oc2cc(F)cc(C#N)c2)c2c1[C@H](O)[C@H](F)C2.N#CN=S(=O)(CF)c1ccc(Oc2cc(F)cc(C#N)c2)c2c1[C@H](O)[C@H](F)C2 |
| InChI | InChI=1S/2C18H12F3N3O3S/c2*19-8-28(26,24-9-23)16-2-1-15(13-6-14(21)18(25)17(13)16)27-12-4-10(7-22)3-11(20)5-12/h2*1-5,14,18,25H,6,8H2/t2*14-,18-,28?/m11/s1 |
| InChIKey | RESWLQOOIDJOPF-LDNPTPMQSA-N |
| XLogP | 7.30 |
| TPSA | 212.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.75 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|