C9H14N4O4S — CID 160605096
5-amino-2-[(3S,4R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1,2,4-triazine-3-thione (PubChem CID 160605096) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is 5-amino-2-[(3S,4R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1,2,4-triazine-3-thione.
| Compound Name | 5-amino-2-[(3S,4R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 160605096 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 5-amino-2-[(3S,4R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1,2,4-triazine-3-thione |
| SMILES | C[C@@]1(O)C(n2ncc(N)nc2=S)OC(CO)[C@H]1O |
| InChI | InChI=1S/C9H14N4O4S/c1-9(16)6(15)4(3-14)17-7(9)13-8(18)12-5(10)2-11-13/h2,4,6-7,14-16H,3H2,1H3,(H2,10,12,18)/t4?,6-,7?,9+/m1/s1 |
| InChIKey | RETQNYCESISNLL-KETCTIRTSA-N |
| XLogP | -1.41 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|