About 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid
4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid (PubChem CID 160607038) has the molecular formula C11H7BrF6O4S
and a molecular weight of 429.13 g/mol. Its IUPAC name is 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid |
| PubChem CID | 160607038 |
| Molecular Formula | C11H7BrF6O4S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid |
| SMILES | O=C1CCc2c1ccc(C(F)(F)F)c2Br.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H6BrF3O.CHF3O3S/c11-9-6-2-4-8(15)5(6)1-3-7(9)10(12,13)14;2-1(3,4)8(5,6)7/h1,3H,2,4H2;(H,5,6,7) |
| InChIKey | REZWOUHKXJHPHP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid?
The IUPAC name of 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid (CID 160607038) is 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid.
What is the SMILES notation for 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid?
The canonical SMILES for 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid is O=C1CCc2c1ccc(C(F)(F)F)c2Br.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid?
The InChIKey is REZWOUHKXJHPHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrF3O.CHF3O3S/c11-9-6-2-4-8(15)5(6)1-3-7(9)10(12,13)14;2-1(3,4)8(5,6)7/h1,3H,2,4H2;(H,5,6,7).
What are the key properties of 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid?
4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid has a molecular weight of 429.13 g/mol, XLogP of 3.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-(trifluoromethyl)-2,3-dihydroinden-1-one;trifluoromethanesulfonic acid is sourced from PubChem (CID 160607038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).