About methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid
methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid (PubChem CID 160607386) has the molecular formula C13H20BNO3
and a molecular weight of 249.12 g/mol. Its IUPAC name is methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid.
Molecular Properties
| Compound Name | methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid |
| PubChem CID | 160607386 |
| Molecular Formula | C13H20BNO3 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid |
| SMILES | C.O=C(c1ccc(B(O)O)cc1)N1CCCCC1 |
| InChI | InChI=1S/C12H16BNO3.CH4/c15-12(14-8-2-1-3-9-14)10-4-6-11(7-5-10)13(16)17;/h4-7,16-17H,1-3,8-9H2;1H4 |
| InChIKey | RFBBSNFMMIFORR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid?
The IUPAC name of methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid (CID 160607386) is methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid.
What is the SMILES notation for methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid?
The canonical SMILES for methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid is C.O=C(c1ccc(B(O)O)cc1)N1CCCCC1.
What is the InChIKey of methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid?
The InChIKey is RFBBSNFMMIFORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BNO3.CH4/c15-12(14-8-2-1-3-9-14)10-4-6-11(7-5-10)13(16)17;/h4-7,16-17H,1-3,8-9H2;1H4.
What are the key properties of methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid?
methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid has a molecular weight of 249.12 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[4-(piperidine-1-carbonyl)phenyl]boronic acid is sourced from PubChem (CID 160607386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).