C12H19F4N2+ — CID 160607747
2-hexyl-1-methyl-1H-imidazol-1-ium;1,1,2,2-tetrafluoroethene (PubChem CID 160607747) has the molecular formula C12H19F4N2+ and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-hexyl-1-methyl-1H-imidazol-1-ium;1,1,2,2-tetrafluoroethene.
| Compound Name | 2-hexyl-1-methyl-1H-imidazol-1-ium;1,1,2,2-tetrafluoroethene |
|---|---|
| PubChem CID | 160607747 |
| Molecular Formula | C12H19F4N2+ |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-hexyl-1-methyl-1H-imidazol-1-ium;1,1,2,2-tetrafluoroethene |
| SMILES | CCCCCCC1=NC=C[NH+]1C.FC(F)=C(F)F |
| InChI | InChI=1S/C10H18N2.C2F4/c1-3-4-5-6-7-10-11-8-9-12(10)2;3-1(4)2(5)6/h8-9H,3-7H2,1-2H3;/p+1 |
| InChIKey | RFCIRSAPUBHBBJ-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|