C27H32N4O2S — CID 160608181
1-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]-3-methylpent-1-yn-3-ol (PubChem CID 160608181) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is 1-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]-3-methylpent-1-yn-3-ol.
| Compound Name | 1-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]-3-methylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 160608181 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 1-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]-3-methylpent-1-yn-3-ol |
| SMILES | CCC(C)(O)C#Cc1cccc(COc2cc(-c3cnc(C4CCN(C)CC4)s3)cnc2N)c1 |
| InChI | InChI=1S/C27H32N4O2S/c1-4-27(2,32)11-8-19-6-5-7-20(14-19)18-33-23-15-22(16-29-25(23)28)24-17-30-26(34-24)21-9-12-31(3)13-10-21/h5-7,14-17,21,32H,4,9-10,12-13,18H2,1-3H3,(H2,28,29) |
| InChIKey | YTBKUTIWFYEENS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|