C21H26FN2O5P — CID 160608514
[(1R,3R)-1-amino-3-[4-[N-[(4-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 160608514) has the molecular formula C21H26FN2O5P and a molecular weight of 436.42 g/mol. Its IUPAC name is [(1R,3R)-1-amino-3-[4-[N-[(4-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3R)-1-amino-3-[4-[N-[(4-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 160608514 |
| Molecular Formula | C21H26FN2O5P |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [(1R,3R)-1-amino-3-[4-[N-[(4-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | CC(=NOCc1ccc(F)cc1)c1ccc([C@@H]2CC[C@](N)(COP(=O)(O)O)C2)cc1 |
| InChI | InChI=1S/C21H26FN2O5P/c1-15(24-28-13-16-2-8-20(22)9-3-16)17-4-6-18(7-5-17)19-10-11-21(23,12-19)14-29-30(25,26)27/h2-9,19H,10-14,23H2,1H3,(H2,25,26,27)/t19-,21-/m1/s1 |
| InChIKey | RFESSAUXAOTECC-TZIWHRDSSA-N |
| XLogP | 3.84 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|