About methane;2-methyl-1,3,2-dioxaphospholan-4-one
methane;2-methyl-1,3,2-dioxaphospholan-4-one (PubChem CID 160609586) has the molecular formula C6H17O3P
and a molecular weight of 168.17 g/mol. Its IUPAC name is methane;2-methyl-1,3,2-dioxaphospholan-4-one.
Molecular Properties
| Compound Name | methane;2-methyl-1,3,2-dioxaphospholan-4-one |
| PubChem CID | 160609586 |
| Molecular Formula | C6H17O3P |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | methane;2-methyl-1,3,2-dioxaphospholan-4-one |
| SMILES | C.C.C.CP1OCC(=O)O1 |
| InChI | InChI=1S/C3H5O3P.3CH4/c1-7-5-2-3(4)6-7;;;/h2H2,1H3;3*1H4 |
| InChIKey | RFILLVCXIUNAHY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methyl-1,3,2-dioxaphospholan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methyl-1,3,2-dioxaphospholan-4-one?
The IUPAC name of methane;2-methyl-1,3,2-dioxaphospholan-4-one (CID 160609586) is methane;2-methyl-1,3,2-dioxaphospholan-4-one.
What is the SMILES notation for methane;2-methyl-1,3,2-dioxaphospholan-4-one?
The canonical SMILES for methane;2-methyl-1,3,2-dioxaphospholan-4-one is C.C.C.CP1OCC(=O)O1.
What is the InChIKey of methane;2-methyl-1,3,2-dioxaphospholan-4-one?
The InChIKey is RFILLVCXIUNAHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5O3P.3CH4/c1-7-5-2-3(4)6-7;;;/h2H2,1H3;3*1H4.
What are the key properties of methane;2-methyl-1,3,2-dioxaphospholan-4-one?
methane;2-methyl-1,3,2-dioxaphospholan-4-one has a molecular weight of 168.17 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-1,3,2-dioxaphospholan-4-one is sourced from PubChem (CID 160609586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).