C18H26F3N3O5S — CID 160609589
1-[5-[2-[4-(2,2,2-trifluoroethoxy)-1H-pyrrol-2-yl]butylsulfonyl]pentyl]imidazolidine-2,4-dione (PubChem CID 160609589) has the molecular formula C18H26F3N3O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is 1-[5-[2-[4-(2,2,2-trifluoroethoxy)-1H-pyrrol-2-yl]butylsulfonyl]pentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[2-[4-(2,2,2-trifluoroethoxy)-1H-pyrrol-2-yl]butylsulfonyl]pentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 160609589 |
| Molecular Formula | C18H26F3N3O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 1-[5-[2-[4-(2,2,2-trifluoroethoxy)-1H-pyrrol-2-yl]butylsulfonyl]pentyl]imidazolidine-2,4-dione |
| SMILES | CCC(CS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1cc(OCC(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C18H26F3N3O5S/c1-2-13(15-8-14(9-22-15)29-12-18(19,20)21)11-30(27,28)7-5-3-4-6-24-10-16(25)23-17(24)26/h8-9,13,22H,2-7,10-12H2,1H3,(H,23,25,26) |
| InChIKey | RFILSRXEBLRQGD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|