C38H30ClN5O8 — CID 160610064
[(1S)-1-(chloromethyl)-3-[6-[(4-ethoxybenzoyl)amino]imidazo[1,2-a]pyridine-2-carbonyl]-9-methyl-1,2-dihydrobenzo[e]indol-5-yl] (4-nitrophenyl) carbonate (PubChem CID 160610064) has the molecular formula C38H30ClN5O8 and a molecular weight of 720.14 g/mol. Its IUPAC name is [(1S)-1-(chloromethyl)-3-[6-[(4-ethoxybenzoyl)amino]imidazo[1,2-a]pyridine-2-carbonyl]-9-methyl-1,2-dihydrobenzo[e]indol-5-yl] (4-nitrophenyl) carbonate.
| Compound Name | [(1S)-1-(chloromethyl)-3-[6-[(4-ethoxybenzoyl)amino]imidazo[1,2-a]pyridine-2-carbonyl]-9-methyl-1,2-dihydrobenzo[e]indol-5-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 160610064 |
| Molecular Formula | C38H30ClN5O8 |
| Molecular Weight | 720.14 g/mol |
| Exact Mass | 719.18 |
| IUPAC Name | [(1S)-1-(chloromethyl)-3-[6-[(4-ethoxybenzoyl)amino]imidazo[1,2-a]pyridine-2-carbonyl]-9-methyl-1,2-dihydrobenzo[e]indol-5-yl] (4-nitrophenyl) carbonate |
| SMILES | CCOc1ccc(C(=O)Nc2ccc3nc(C(=O)N4C[C@@H](CCl)c5c4cc(OC(=O)Oc4ccc([N+](=O)[O-])cc4)c4cccc(C)c54)cn3c2)cc1 |
| InChI | InChI=1S/C38H30ClN5O8/c1-3-50-27-12-7-23(8-13-27)36(45)40-25-9-16-33-41-30(21-42(33)20-25)37(46)43-19-24(18-39)35-31(43)17-32(29-6-4-5-22(2)34(29)35)52-38(47)51-28-14-10-26(11-15-28)44(48)49/h4-17,20-21,24H,3,18-19H2,1-2H3,(H,40,45)/t24-/m1/s1 |
| InChIKey | RFJYNCMKXBONRK-XMMPIXPASA-N |
| XLogP | 7.92 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.14 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|