About 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene
3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene (PubChem CID 160610785) has the molecular formula C23H35NOS2
and a molecular weight of 405.67 g/mol. Its IUPAC name is 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene.
Molecular Properties
| Compound Name | 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene |
| PubChem CID | 160610785 |
| Molecular Formula | C23H35NOS2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene |
| SMILES | Cc1ccoc1C(C)C.Cc1ccsc1C(C)C.Cc1csnc1C(C)C |
| InChI | InChI=1S/C8H12O.C8H12S.C7H11NS/c2*1-6(2)8-7(3)4-5-9-8;1-5(2)7-6(3)4-9-8-7/h2*4-6H,1-3H3;4-5H,1-3H3 |
| InChIKey | RFMHMHXUSUHXSQ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene?
The IUPAC name of 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene (CID 160610785) is 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene.
What is the SMILES notation for 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene?
The canonical SMILES for 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene is Cc1ccoc1C(C)C.Cc1ccsc1C(C)C.Cc1csnc1C(C)C.
What is the InChIKey of 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene?
The InChIKey is RFMHMHXUSUHXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.C8H12S.C7H11NS/c2*1-6(2)8-7(3)4-5-9-8;1-5(2)7-6(3)4-9-8-7/h2*4-6H,1-3H3;4-5H,1-3H3.
What are the key properties of 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene?
3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene has a molecular weight of 405.67 g/mol, XLogP of 8.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-propan-2-ylfuran;4-methyl-3-propan-2-yl-1,2-thiazole;3-methyl-2-propan-2-ylthiophene is sourced from PubChem (CID 160610785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).