C24H22N4O2 — CID 160610955
1-(2,6-dimethyl-4-pyrimidin-5-ylphenoxy)-3-(1H-indol-4-ylmethylideneamino)propan-2-one (PubChem CID 160610955) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-pyrimidin-5-ylphenoxy)-3-(1H-indol-4-ylmethylideneamino)propan-2-one.
| Compound Name | 1-(2,6-dimethyl-4-pyrimidin-5-ylphenoxy)-3-(1H-indol-4-ylmethylideneamino)propan-2-one |
|---|---|
| PubChem CID | 160610955 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-(2,6-dimethyl-4-pyrimidin-5-ylphenoxy)-3-(1H-indol-4-ylmethylideneamino)propan-2-one |
| SMILES | Cc1cc(-c2cncnc2)cc(C)c1OCC(=O)C/N=C/c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C24H22N4O2/c1-16-8-19(20-11-26-15-27-12-20)9-17(2)24(16)30-14-21(29)13-25-10-18-4-3-5-23-22(18)6-7-28-23/h3-12,15,28H,13-14H2,1-2H3/b25-10+ |
| InChIKey | RFMUHHCDCPKMDQ-KIBLKLHPSA-N |
| XLogP | 4.31 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|