C14H14F2N4 — CID 160611567
4,8-difluoro-1-N,5-N,3,7-tetramethylnaphthalene-1,2,5,6-tetraimine (PubChem CID 160611567) has the molecular formula C14H14F2N4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4,8-difluoro-1-N,5-N,3,7-tetramethylnaphthalene-1,2,5,6-tetraimine.
| Compound Name | 4,8-difluoro-1-N,5-N,3,7-tetramethylnaphthalene-1,2,5,6-tetraimine |
|---|---|
| PubChem CID | 160611567 |
| Molecular Formula | C14H14F2N4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4,8-difluoro-1-N,5-N,3,7-tetramethylnaphthalene-1,2,5,6-tetraimine |
| SMILES | [H]/N=c1\c(C)c(F)c2c(=N/C)/c(=N/[H])c(C)c(F)c=2\c1=N\C |
| InChI | InChI=1S/C14H14F2N4/c1-5-9(15)7-8(13(19-3)11(5)17)10(16)6(2)12(18)14(7)20-4/h17-18H,1-4H3/b17-11+,18-12+,19-13-,20-14- |
| InChIKey | RFOARHUGEWAISE-MIYNHGSZSA-N |
| XLogP | 0.20 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |