C41H58 — CID 160612345
(4aS,11aS,12S,12aS)-2,4a,5,7,11a,12a-hexamethyl-11-(5-methylhexyl)-4,6-dimethylidene-12-(2-methylidenebutyl)-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene (PubChem CID 160612345) has the molecular formula C41H58 and a molecular weight of 550.92 g/mol. Its IUPAC name is (4aS,11aS,12S,12aS)-2,4a,5,7,11a,12a-hexamethyl-11-(5-methylhexyl)-4,6-dimethylidene-12-(2-methylidenebutyl)-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene.
| Compound Name | (4aS,11aS,12S,12aS)-2,4a,5,7,11a,12a-hexamethyl-11-(5-methylhexyl)-4,6-dimethylidene-12-(2-methylidenebutyl)-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene |
|---|---|
| PubChem CID | 160612345 |
| Molecular Formula | C41H58 |
| Molecular Weight | 550.92 g/mol |
| Exact Mass | 550.45 |
| IUPAC Name | (4aS,11aS,12S,12aS)-2,4a,5,7,11a,12a-hexamethyl-11-(5-methylhexyl)-4,6-dimethylidene-12-(2-methylidenebutyl)-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene |
| SMILES | C=C(CC)C[C@H]1[C@]2(C)CC(C)=C(C(=C)C)C(=C)[C@]2(C)C(C)=C2C(=C)c3c(C)cccc3C(CCCCC(C)C)[C@@]21C |
| InChI | InChI=1S/C41H58/c1-15-27(6)23-35-39(12)24-29(8)36(26(4)5)31(10)41(39,14)32(11)38-30(9)37-28(7)20-18-21-33(37)34(40(35,38)13)22-17-16-19-25(2)3/h18,20-21,25,34-35H,4,6,9-10,15-17,19,22-24H2,1-3,5,7-8,11-14H3/t34?,35-,39-,40+,41+/m0/s1 |
| InChIKey | RFQOFHSLCJOHJH-NVIFWAHGSA-N |
| XLogP | 12.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.92 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|