C44H60O6P2 — CID 160613277
1,1'-biphenyl;bis(bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-trihydroxy-λ5-phosphane) (PubChem CID 160613277) has the molecular formula C44H60O6P2 and a molecular weight of 746.91 g/mol. Its IUPAC name is 1,1'-biphenyl;bis(bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-trihydroxy-λ5-phosphane).
| Compound Name | 1,1'-biphenyl;bis(bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-trihydroxy-λ5-phosphane) |
|---|---|
| PubChem CID | 160613277 |
| Molecular Formula | C44H60O6P2 |
| Molecular Weight | 746.91 g/mol |
| Exact Mass | 746.39 |
| IUPAC Name | 1,1'-biphenyl;bis(bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-trihydroxy-λ5-phosphane) |
| SMILES | CC1C=CC=CC1(C)P(O)(O)(O)C1(C)C=CC=CC1C.CC1C=CC=CC1(C)P(O)(O)(O)C1(C)C=CC=CC1C.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/2C16H25O3P.C12H10/c2*1-13-9-5-7-11-15(13,3)20(17,18,19)16(4)12-8-6-10-14(16)2;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h2*5-14,17-19H,1-4H3;1-10H |
| InChIKey | RFTHYTVSIYACNB-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.91 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|