About 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol
2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol (PubChem CID 160616138) has the molecular formula C32H32N2O4
and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol |
| PubChem CID | 160616138 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol |
| SMILES | CCc1ncc(C)[nH]1.Oc1ccc(C(c2ccc(O)cc2)C(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H22O4.C6H10N2/c27-21-9-1-17(2-10-21)25(18-3-11-22(28)12-4-18)26(19-5-13-23(29)14-6-19)20-7-15-24(30)16-8-20;1-3-6-7-4-5(2)8-6/h1-16,25-30H;4H,3H2,1-2H3,(H,7,8) |
| InChIKey | RGCRIMAIDHCPJP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol?
The IUPAC name of 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol (CID 160616138) is 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol.
What is the SMILES notation for 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol?
The canonical SMILES for 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol is CCc1ncc(C)[nH]1.Oc1ccc(C(c2ccc(O)cc2)C(c2ccc(O)cc2)c2ccc(O)cc2)cc1.
What is the InChIKey of 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol?
The InChIKey is RGCRIMAIDHCPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O4.C6H10N2/c27-21-9-1-17(2-10-21)25(18-3-11-22(28)12-4-18)26(19-5-13-23(29)14-6-19)20-7-15-24(30)16-8-20;1-3-6-7-4-5(2)8-6/h1-16,25-30H;4H,3H2,1-2H3,(H,7,8).
What are the key properties of 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol?
2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol has a molecular weight of 508.62 g/mol, XLogP of 6.75, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-1H-imidazole;4-[1,2,2-tris(4-hydroxyphenyl)ethyl]phenol is sourced from PubChem (CID 160616138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).