C28H28BBrN6O2 — CID 160616322
(3-aminophenyl)boronic acid;5-bromo-3-methyl-1H-pyrrolo[2,3-b]pyridine;3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline (PubChem CID 160616322) has the molecular formula C28H28BBrN6O2 and a molecular weight of 571.29 g/mol. Its IUPAC name is (3-aminophenyl)boronic acid;5-bromo-3-methyl-1H-pyrrolo[2,3-b]pyridine;3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline.
| Compound Name | (3-aminophenyl)boronic acid;5-bromo-3-methyl-1H-pyrrolo[2,3-b]pyridine;3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline |
|---|---|
| PubChem CID | 160616322 |
| Molecular Formula | C28H28BBrN6O2 |
| Molecular Weight | 571.29 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | (3-aminophenyl)boronic acid;5-bromo-3-methyl-1H-pyrrolo[2,3-b]pyridine;3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline |
| SMILES | Cc1c[nH]c2ncc(-c3cccc(N)c3)cc12.Cc1c[nH]c2ncc(Br)cc12.Nc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C14H13N3.C8H7BrN2.C6H8BNO2/c1-9-7-16-14-13(9)6-11(8-17-14)10-3-2-4-12(15)5-10;1-5-3-10-8-7(5)2-6(9)4-11-8;8-6-3-1-2-5(4-6)7(9)10/h2-8H,15H2,1H3,(H,16,17);2-4H,1H3,(H,10,11);1-4,9-10H,8H2 |
| InChIKey | RGDHDPZQIIELLK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|