C18H32N4 — CID 160616860
3-methyl-6-propan-2-yl-1,2,4,5-tetrazine;(1E)-6-propan-2-ylcyclononene (PubChem CID 160616860) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine;(1E)-6-propan-2-ylcyclononene.
| Compound Name | 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine;(1E)-6-propan-2-ylcyclononene |
|---|---|
| PubChem CID | 160616860 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine;(1E)-6-propan-2-ylcyclononene |
| SMILES | CC(C)C1CCC/C=C/CCC1.Cc1nnc(C(C)C)nn1 |
| InChI | InChI=1S/C12H22.C6H10N4/c1-11(2)12-9-7-5-3-4-6-8-10-12;1-4(2)6-9-7-5(3)8-10-6/h3-4,11-12H,5-10H2,1-2H3;4H,1-3H3/b4-3+; |
| InChIKey | RGEZCXHLKLOFPK-BJILWQEISA-N |
| XLogP | 4.87 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|