C15H17F2N3 — CID 160618320
N-(3,3-difluoropent-4-enyl)-N-(1H-imidazol-2-ylmethyl)aniline (PubChem CID 160618320) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-(3,3-difluoropent-4-enyl)-N-(1H-imidazol-2-ylmethyl)aniline.
| Compound Name | N-(3,3-difluoropent-4-enyl)-N-(1H-imidazol-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 160618320 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-(3,3-difluoropent-4-enyl)-N-(1H-imidazol-2-ylmethyl)aniline |
| SMILES | C=CC(F)(F)CCN(Cc1ncc[nH]1)c1ccccc1 |
| InChI | InChI=1S/C15H17F2N3/c1-2-15(16,17)8-11-20(12-14-18-9-10-19-14)13-6-4-3-5-7-13/h2-7,9-10H,1,8,11-12H2,(H,18,19) |
| InChIKey | RGJLWHQFNILVHB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|