About (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol
(Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol (PubChem CID 160618683) has the molecular formula C8H17N3O5
and a molecular weight of 235.24 g/mol. Its IUPAC name is (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol.
Molecular Properties
| Compound Name | (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol |
| PubChem CID | 160618683 |
| Molecular Formula | C8H17N3O5 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol |
| SMILES | NNC(=O)/C=C\C(=O)O.OCCNCCO |
| InChI | InChI=1S/C4H6N2O3.C4H11NO2/c5-6-3(7)1-2-4(8)9;6-3-1-5-2-4-7/h1-2H,5H2,(H,6,7)(H,8,9);5-7H,1-4H2/b2-1-; |
| InChIKey | RGKQZJLSGXQWJV-ODZAUARKSA-N |
| XLogP | -2.82 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol?
The IUPAC name of (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol (CID 160618683) is (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol.
What is the SMILES notation for (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol?
The canonical SMILES for (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol is NNC(=O)/C=C\C(=O)O.OCCNCCO.
What is the InChIKey of (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol?
The InChIKey is RGKQZJLSGXQWJV-ODZAUARKSA-N. The full InChI is InChI=1S/C4H6N2O3.C4H11NO2/c5-6-3(7)1-2-4(8)9;6-3-1-5-2-4-7/h1-2H,5H2,(H,6,7)(H,8,9);5-7H,1-4H2/b2-1-;.
What are the key properties of (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol?
(Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol has a molecular weight of 235.24 g/mol, XLogP of -2.82, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydrazinyl-4-oxobut-2-enoic acid;2-(2-hydroxyethylamino)ethanol is sourced from PubChem (CID 160618683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).