C48H61ClO8 — CID 160619357
bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methanol;bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl prop-2-enoate;prop-2-enoyl chloride (PubChem CID 160619357) has the molecular formula C48H61ClO8 and a molecular weight of 801.46 g/mol. Its IUPAC name is bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methanol;bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl prop-2-enoate;prop-2-enoyl chloride.
| Compound Name | bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methanol;bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl prop-2-enoate;prop-2-enoyl chloride |
|---|---|
| PubChem CID | 160619357 |
| Molecular Formula | C48H61ClO8 |
| Molecular Weight | 801.46 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methanol;bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl prop-2-enoate;prop-2-enoyl chloride |
| SMILES | C=CC(=O)Cl.C=CC(=O)OC(c1ccc(OC(C)(C)C)cc1)c1ccc(OC(C)(C)C)cc1.CC(C)(C)Oc1ccc(C(O)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H30O4.C21H28O3.C3H3ClO/c1-8-21(25)26-22(17-9-13-19(14-10-17)27-23(2,3)4)18-11-15-20(16-12-18)28-24(5,6)7;1-20(2,3)23-17-11-7-15(8-12-17)19(22)16-9-13-18(14-10-16)24-21(4,5)6;1-2-3(4)5/h8-16,22H,1H2,2-7H3;7-14,19,22H,1-6H3;2H,1H2 |
| InChIKey | RGMSXQNIJKLCAB-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.46 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|