About 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine
1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine (PubChem CID 160619641) has the molecular formula C8H14I2N2O2
and a molecular weight of 424.02 g/mol. Its IUPAC name is 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine.
Molecular Properties
| Compound Name | 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine |
| PubChem CID | 160619641 |
| Molecular Formula | C8H14I2N2O2 |
| Molecular Weight | 424.02 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine |
| SMILES | CN1CCC(=O)N(C)CCC1=O.II |
| InChI | InChI=1S/C8H14N2O2.I2/c1-9-5-3-8(12)10(2)6-4-7(9)11;1-2/h3-6H2,1-2H3; |
| InChIKey | RGNQOIZDCMJEMT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.02 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine?
The IUPAC name of 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine (CID 160619641) is 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine.
What is the SMILES notation for 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine?
The canonical SMILES for 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine is CN1CCC(=O)N(C)CCC1=O.II.
What is the InChIKey of 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine?
The InChIKey is RGNQOIZDCMJEMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.I2/c1-9-5-3-8(12)10(2)6-4-7(9)11;1-2/h3-6H2,1-2H3;.
What are the key properties of 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine?
1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine has a molecular weight of 424.02 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-1,5-diazocane-2,6-dione;molecular iodine is sourced from PubChem (CID 160619641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).