C32H26I2 — CID 160620246
3,6-bis[4-(4-iodophenyl)phenyl]-3,6-dimethylcyclohexa-1,4-diene (PubChem CID 160620246) has the molecular formula C32H26I2 and a molecular weight of 664.37 g/mol. Its IUPAC name is 3,6-bis[4-(4-iodophenyl)phenyl]-3,6-dimethylcyclohexa-1,4-diene.
| Compound Name | 3,6-bis[4-(4-iodophenyl)phenyl]-3,6-dimethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 160620246 |
| Molecular Formula | C32H26I2 |
| Molecular Weight | 664.37 g/mol |
| Exact Mass | 664.01 |
| IUPAC Name | 3,6-bis[4-(4-iodophenyl)phenyl]-3,6-dimethylcyclohexa-1,4-diene |
| SMILES | CC1(c2ccc(-c3ccc(I)cc3)cc2)C=CC(C)(c2ccc(-c3ccc(I)cc3)cc2)C=C1 |
| InChI | InChI=1S/C32H26I2/c1-31(27-11-3-23(4-12-27)25-7-15-29(33)16-8-25)19-21-32(2,22-20-31)28-13-5-24(6-14-28)26-9-17-30(34)18-10-26/h3-22H,1-2H3 |
| InChIKey | WSDYOTKLIIWSDU-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.37 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|