About 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid
5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid (PubChem CID 160620649) has the molecular formula C19H16N2O6
and a molecular weight of 368.35 g/mol. Its IUPAC name is 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid |
| PubChem CID | 160620649 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc(C(=O)O)c1.O=C(O)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C10H8N2O2.C9H8O4/c13-10(14)8-6-11-12-9(8)7-4-2-1-3-5-7;1-5-2-6(8(10)11)4-7(3-5)9(12)13/h1-6H,(H,11,12)(H,13,14);2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | RGQQPMIWUZHARD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid?
The IUPAC name of 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid (CID 160620649) is 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid.
What is the SMILES notation for 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid?
The canonical SMILES for 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid is Cc1cc(C(=O)O)cc(C(=O)O)c1.O=C(O)c1cn[nH]c1-c1ccccc1.
What is the InChIKey of 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid?
The InChIKey is RGQQPMIWUZHARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.C9H8O4/c13-10(14)8-6-11-12-9(8)7-4-2-1-3-5-7;1-5-2-6(8(10)11)4-7(3-5)9(12)13/h1-6H,(H,11,12)(H,13,14);2-4H,1H3,(H,10,11)(H,12,13).
What are the key properties of 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid?
5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid has a molecular weight of 368.35 g/mol, XLogP of 3.17, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylbenzene-1,3-dicarboxylic acid;5-phenyl-1H-pyrazole-4-carboxylic acid is sourced from PubChem (CID 160620649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).