C17H22N4O9S2 — CID 160621703
3-aminobenzenesulfonic acid;(2S)-2-amino-3-[(4-methyl-3-sulfophenyl)carbamoylamino]propanoic acid (PubChem CID 160621703) has the molecular formula C17H22N4O9S2 and a molecular weight of 490.52 g/mol. Its IUPAC name is 3-aminobenzenesulfonic acid;(2S)-2-amino-3-[(4-methyl-3-sulfophenyl)carbamoylamino]propanoic acid.
| Compound Name | 3-aminobenzenesulfonic acid;(2S)-2-amino-3-[(4-methyl-3-sulfophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 160621703 |
| Molecular Formula | C17H22N4O9S2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 3-aminobenzenesulfonic acid;(2S)-2-amino-3-[(4-methyl-3-sulfophenyl)carbamoylamino]propanoic acid |
| SMILES | Cc1ccc(NC(=O)NC[C@H](N)C(=O)O)cc1S(=O)(=O)O.Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H15N3O6S.C6H7NO3S/c1-6-2-3-7(4-9(6)21(18,19)20)14-11(17)13-5-8(12)10(15)16;7-5-2-1-3-6(4-5)11(8,9)10/h2-4,8H,5,12H2,1H3,(H,15,16)(H2,13,14,17)(H,18,19,20);1-4H,7H2,(H,8,9,10)/t8-;/m0./s1 |
| InChIKey | RGUAXFUZDYYIBQ-QRPNPIFTSA-N |
| XLogP | 0.29 |
| TPSA | 239.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|