C17H22F3NO12S3 — CID 160621814
S-[(3R,6S)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate;S-[(3S,6S)-3-(trifluoromethylsulfonyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate (PubChem CID 160621814) has the molecular formula C17H22F3NO12S3 and a molecular weight of 585.55 g/mol. Its IUPAC name is S-[(3R,6S)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate;S-[(3S,6S)-3-(trifluoromethylsulfonyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate.
| Compound Name | S-[(3R,6S)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate;S-[(3S,6S)-3-(trifluoromethylsulfonyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate |
|---|---|
| PubChem CID | 160621814 |
| Molecular Formula | C17H22F3NO12S3 |
| Molecular Weight | 585.55 g/mol |
| Exact Mass | 585.03 |
| IUPAC Name | S-[(3R,6S)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate;S-[(3S,6S)-3-(trifluoromethylsulfonyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1COC2C1OC[C@@H]2OS(=O)(=O)C(F)(F)F.CC(=O)S[C@H]1COC2C1OC[C@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C9H11F3O6S2.C8H11NO6S/c1-4(13)19-6-3-17-7-5(2-16-8(6)7)18-20(14,15)9(10,11)12;1-4(10)16-6-3-14-7-5(15-9(11)12)2-13-8(6)7/h5-8H,2-3H2,1H3;5-8H,2-3H2,1H3/t5-,6-,7?,8?;5-,6+,7?,8?/m01/s1 |
| InChIKey | RGUKFJGMTSLVEQ-NWVFVRAQSA-N |
| XLogP | 0.68 |
| TPSA | 166.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.55 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|