About fluoroform;3-phenyl-1H-indazole
fluoroform;3-phenyl-1H-indazole (PubChem CID 160622015) has the molecular formula C14H11F3N2
and a molecular weight of 264.25 g/mol. Its IUPAC name is fluoroform;3-phenyl-1H-indazole.
Molecular Properties
| Compound Name | fluoroform;3-phenyl-1H-indazole |
| PubChem CID | 160622015 |
| Molecular Formula | C14H11F3N2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | fluoroform;3-phenyl-1H-indazole |
| SMILES | FC(F)F.c1ccc(-c2n[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C13H10N2.CHF3/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)14-15-13;2-1(3)4/h1-9H,(H,14,15);1H |
| InChIKey | RGVBNUPRCHRXIH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoroform;3-phenyl-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;3-phenyl-1H-indazole?
The IUPAC name of fluoroform;3-phenyl-1H-indazole (CID 160622015) is fluoroform;3-phenyl-1H-indazole.
What is the SMILES notation for fluoroform;3-phenyl-1H-indazole?
The canonical SMILES for fluoroform;3-phenyl-1H-indazole is FC(F)F.c1ccc(-c2n[nH]c3ccccc23)cc1.
What is the InChIKey of fluoroform;3-phenyl-1H-indazole?
The InChIKey is RGVBNUPRCHRXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2.CHF3/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)14-15-13;2-1(3)4/h1-9H,(H,14,15);1H.
What are the key properties of fluoroform;3-phenyl-1H-indazole?
fluoroform;3-phenyl-1H-indazole has a molecular weight of 264.25 g/mol, XLogP of 4.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;3-phenyl-1H-indazole is sourced from PubChem (CID 160622015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).