About 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride
5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride (PubChem CID 160624526) has the molecular formula C7H17ClN2O
and a molecular weight of 180.68 g/mol. Its IUPAC name is 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride |
| PubChem CID | 160624526 |
| Molecular Formula | C7H17ClN2O |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CCC(C)(C)CO |
| InChI | InChI=1S/C7H16N2O.ClH/c1-7(2,5-10)4-3-6(8)9;/h10H,3-5H2,1-2H3,(H3,8,9);1H |
| InChIKey | DDNYXABGAOKMRT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride?
The IUPAC name of 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride (CID 160624526) is 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride.
What is the SMILES notation for 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride?
The canonical SMILES for 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride is Cl.[H]/N=C(\N)CCC(C)(C)CO.
What is the InChIKey of 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride?
The InChIKey is DDNYXABGAOKMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O.ClH/c1-7(2,5-10)4-3-6(8)9;/h10H,3-5H2,1-2H3,(H3,8,9);1H.
What are the key properties of 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride?
5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride has a molecular weight of 180.68 g/mol, XLogP of 1.14, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-4,4-dimethylpentanimidamide;hydrochloride is sourced from PubChem (CID 160624526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).