C25H25N5O2 — CID 160624986
[5-amino-1-(2-methyl-3H-benzimidazol-5-yl)pyrazol-4-yl]-(5-butoxy-1H-inden-2-yl)methanone (PubChem CID 160624986) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is [5-amino-1-(2-methyl-3H-benzimidazol-5-yl)pyrazol-4-yl]-(5-butoxy-1H-inden-2-yl)methanone.
| Compound Name | [5-amino-1-(2-methyl-3H-benzimidazol-5-yl)pyrazol-4-yl]-(5-butoxy-1H-inden-2-yl)methanone |
|---|---|
| PubChem CID | 160624986 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [5-amino-1-(2-methyl-3H-benzimidazol-5-yl)pyrazol-4-yl]-(5-butoxy-1H-inden-2-yl)methanone |
| SMILES | CCCCOc1ccc2c(c1)C=C(C(=O)c1cnn(-c3ccc4nc(C)[nH]c4c3)c1N)C2 |
| InChI | InChI=1S/C25H25N5O2/c1-3-4-9-32-20-7-5-16-10-18(11-17(16)12-20)24(31)21-14-27-30(25(21)26)19-6-8-22-23(13-19)29-15(2)28-22/h5-8,11-14H,3-4,9-10,26H2,1-2H3,(H,28,29) |
| InChIKey | RHEJOTSJVSUJMB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|